Lesson plan

S416

{{drugbox | drug_name = S416 | image = S416_structure.png | image_class = skin-invert-image | legal_UK = | legal_DE = | C = 18 | H = 14 | Cl = 1 | N = 3 | O = 2 | S =1 | IUPAC_name = 2-[(E)-[[4-(2-chlorophenyl)-1,3-thiazol-2-yl]-methylhydrazinylidene}]methyl]benzoic acid | CAS_number_Ref = | CAS_number = 2118370-02-6 | ChemSpiderID = | PubChem = 148568163 | smiles = CN(C1=NC(=CS1)C2=CC=CC=C2Cl)/N=C\C3=CC=CC=C3C(=O)O | StdInChI = 1S/C18H14ClN3O2S/c1-22(20-10-12-6-2-3-7-13(12)17(23)24)18-21-16(11-25-18)14-8-4-5-9-15(14)19/h2-11H,1H3,(H,23,24)/b20-10- | StdInChIKey = MWIQPUXVXAVFRM-JMIUGGIZSA-N }} S416 (GTPL-11164) is a drug which acts as a selective inhibitor of the enzyme dihydroorotate dehydrogenase (DHODH). This enzyme is involved in the synthesis of pyrimidine nucleosides in the body, which are required for the synthesis of DNA and RNA. This is an important rate-limiting step in the replication of viruses, and so DHODH inhibitors may have applications as broad-spectrum antiviral drugs. In tests in vitro, S416 was found to have antiviral activity against a range of pathogenic RNA viruses including influenza, Zika virus, Ebola virus and SARS-CoV-2.

Back to article

Article summary

{{drugbox | drug_name = S416 | image = S416_structure.png | image_class = skin-invert-image | legal_UK = | legal_DE = | C = 18 | H = 14 | Cl = 1 | N = 3 | O = 2 | S =1 | IUPAC_name = 2-[(E)-[[4-(2-chlorophenyl)-1,3-thiazol-2-yl]-methylhydrazinylidene}]methyl]benzoic acid | CAS_number_Ref = | CAS_number = 2118370-02-6 | ChemSpiderID = | PubChem = 148568163 | smiles = CN(C1=NC(=CS1)C2=CC=CC=C2Cl)/N=C\C3=CC=CC=C3C(=O)O | StdInChI = 1S/C18H14ClN3O2S/c1-22(20-10-12-6-2-3-7-13(12)17(23)24)18-21-16(11-25-18)14-8-4-5-9-15(14)19/h2-11H,1H3,(H,23,24)/b20-10- | StdInChIKey = MWIQPUXVXAVFRM-JMIUGGIZSA-N }} S416 (GTPL-11164) is a drug which acts as a selective inhibitor of the enzyme dihydroorotate dehydrogenase (DHODH). This enzyme is involved in the synthesis of pyrimidine nucleosides in the body, which are required for the synthesis of DNA and RNA. This is an important rate-limiting step in the replication of viruses, and so DHODH inhibitors may have applications as broad-spectrum antiviral drugs. In tests in vitro, S416 was found to have antiviral activity against a range of pathogenic RNA viruses including influenza, Zika virus, Ebola virus and SARS-CoV-2.

Key claims

No claims recorded.

Discussion questions

  1. Summarise the article in your own words. Which single claim would you verify first, and why?
  2. Which claim in this article is most likely to be revised as the sources update? How would you check its current status?
  3. If two sources disagreed about one of these facts, what would you need in order to trust one over the other?

Bibliography

No sources recorded.

Key claims and bibliography are generated from the same tracked claims and sources as the article page.